![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| (2020) Vyana/ | 2023-10-25 15:04 | - | |
| (2013) Tarot/ | 2023-10-25 15:04 | - | |
| (2013) Invisible Balance/ | 2023-10-25 15:04 | - | |
| (2013) Point Of View/ | 2023-10-25 15:04 | - | |
| (2013) Solar Plexus/ | 2023-10-25 15:04 | - | |
| (2012) Verträumt/ | 2023-10-25 15:05 | - | |
| (2012) Cosmic Shapes/ | 2023-10-25 15:05 | - | |
| (2011) Dub Asana/ | 2023-10-25 15:05 | - | |
| (2012) Afterglow/ | 2023-10-25 15:05 | - | |
| (2020) Re-Connected/ | 2023-10-25 15:05 | - | |
| (2011) Autumn Movement/ | 2023-10-25 15:05 | - | |
| (2016) Granite Remixes/ | 2023-10-25 15:05 | - | |
| (2018) Ligand Remixes/ | 2023-10-25 15:05 | - | |
| (2015) Sense Of Life/ | 2023-10-25 15:05 | - | |
| (2014) Moon Arrival Remixes/ | 2023-10-25 15:06 | - | |
| (2015) Isolatedmix 59 - Inside/ | 2023-10-25 15:06 | - | |
| (2020) Apana/ | 2023-10-25 15:07 | - | |
| (2012) Realize/ | 2023-10-25 15:07 | - | |