![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2023-10-25 16:29 | 41K | |
| 07. The Monolith.flac | 2023-10-26 05:29 | 12M | |
| 13. October.flac | 2023-10-26 06:09 | 15M | |
| 01. Wingspan.flac | 2023-10-26 08:17 | 15M | |
| 11. Cerebral.flac | 2023-10-26 07:37 | 15M | |
| 03. View From Above.flac | 2023-10-26 07:18 | 20M | |
| 08. Vacant Smiles.flac | 2023-10-26 05:56 | 25M | |
| 05. Take Your Time (Remix).flac | 2023-10-26 07:57 | 34M | |
| 09. Persian Dawn.flac | 2023-10-26 08:53 | 41M | |
| 12. Frequency (Re-Edit).flac | 2023-10-26 06:53 | 41M | |
| 10. Lightsphere.flac | 2023-10-26 07:44 | 43M | |
| 06. Silent Angel.flac | 2023-10-26 08:24 | 46M | |
| 02. The Synthetic.flac | 2023-10-26 05:36 | 47M | |
| 04. Earthlink.flac | 2023-10-26 07:35 | 48M | |
| 14. Last Flight.flac | 2023-10-26 08:33 | 54M | |