![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Here's to You.mp3 | 2023-10-29 08:51 | 11M | |
| 02 - The Inconvenient (Imperative Reaction Remix).mp3 | 2023-10-29 08:47 | 8.7M | |
| 03 - Here's to You (Aesthetic Perfection Remix).mp3 | 2023-10-29 08:52 | 10M | |
| 04 - Losing My Religion.mp3 | 2023-10-29 08:52 | 10M | |
| 05 - Here's to You (Interface Remix).mp3 | 2023-10-29 08:52 | 12M | |
| 06 - Lead.mp3 | 2023-10-29 08:37 | 5.4M | |
| 07 - Here's to You (Martyr Mind Mix).mp3 | 2023-10-29 08:52 | 11M | |
| cover.jpg | 2023-10-29 08:25 | 61K | |
