![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 momentary absolution (imperative reaction remix).mp3 | 2023-10-29 08:44 | 7.0M | |
| 02 ruthless (mentallo and the fixer cover).mp3 | 2023-10-29 08:52 | 6.7M | |
| 03 tracing veins (club mix).mp3 | 2023-10-29 08:41 | 6.3M | |
| 04 man made.mp3 | 2023-10-29 08:48 | 5.9M | |
| 05 waiting.mp3 | 2023-10-29 08:51 | 6.1M | |
| 06 a new england (billy bragg cover).mp3 | 2023-10-29 08:49 | 4.7M | |
| 07 divide (by electromedica).mp3 | 2023-10-29 08:47 | 7.0M | |
| 08 exalt (by lidless eye ficker).mp3 | 2023-10-29 08:49 | 6.6M | |
| cover.jpg | 2023-10-29 08:21 | 74K | |
| disc.jpg | 2023-10-29 08:21 | 84K | |
