![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - The Fall.mp3 | 2023-10-29 08:52 | 8.9M | |
| 02 - Chemical.mp3 | 2023-10-29 08:50 | 8.1M | |
| 03 - The Inconvenient.mp3 | 2023-10-29 08:50 | 9.3M | |
| 04 - God And Country.mp3 | 2023-10-29 08:52 | 12M | |
| 05 - Rex Mortuus Est.mp3 | 2023-10-29 08:49 | 9.1M | |
| 06 - Drone.mp3 | 2023-10-29 08:50 | 9.2M | |
| 07 - Here’s To You.mp3 | 2023-10-29 08:46 | 11M | |
| 08 - Strangers.mp3 | 2023-10-29 08:50 | 11M | |
| 09 - A Better Day Tomorrow.mp3 | 2023-10-29 08:52 | 12M | |
| 10 - Hospitals.mp3 | 2023-10-29 08:50 | 9.9M | |
| 11 - Curtain Call.mp3 | 2023-10-29 08:51 | 11M | |
| cover.jpg | 2023-10-29 06:36 | 83K | |
