![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Ki.mp3 | 2023-10-29 07:47 | 3.6M | |
| 02. Alpha.mp3 | 2023-10-29 08:10 | 23M | |
| 03. Dead Voxel.mp3 | 2023-10-29 08:08 | 11M | |
| 04. Blind Spots.mp3 | 2023-10-29 08:11 | 13M | |
| 05. Flake.mp3 | 2023-10-29 07:55 | 6.6M | |
| 06. Moog City 2.mp3 | 2023-10-29 07:55 | 7.0M | |
| 07. Concrete Halls.mp3 | 2023-10-29 08:09 | 9.8M | |
| 08. Biome Fest.mp3 | 2023-10-29 08:09 | 15M | |
| 09. Mutation.mp3 | 2023-10-29 08:09 | 7.2M | |
| 10. Haunt Muskie.mp3 | 2023-10-29 08:11 | 14M | |
| 11. Warmth.mp3 | 2023-10-29 08:05 | 9.2M | |
| 12. Floating Trees.mp3 | 2023-10-29 08:10 | 9.4M | |
| 13. Aria Math.mp3 | 2023-10-29 07:56 | 12M | |
| 14. Kyoto.mp3 | 2023-10-29 08:10 | 9.6M | |
| 15. Ballad of the Cats.mp3 | 2023-10-29 08:10 | 11M | |
| 16. Taswell.mp3 | 2023-10-29 08:10 | 20M | |
| 17. Beginning 2.mp3 | 2023-10-29 08:06 | 6.8M | |
| 18. Dreiton.mp3 | 2023-10-29 08:10 | 19M | |
| 19. The End.mp3 | 2023-10-29 08:11 | 35M | |
| 20. Chirp.mp3 | 2023-10-29 08:10 | 7.2M | |
| 21. Wait.mp3 | 2023-10-29 08:09 | 9.0M | |
| 22. Mellohi.mp3 | 2023-10-29 07:36 | 3.8M | |
| 23. Stal.mp3 | 2023-10-29 07:55 | 5.9M | |
| 24. Strad.mp3 | 2023-10-29 08:10 | 7.3M | |
| 25. Eleven.mp3 | 2023-10-29 07:46 | 2.8M | |
| 26. Ward.mp3 | 2023-10-29 08:11 | 9.6M | |
| 27. Mall.mp3 | 2023-10-29 07:56 | 7.6M | |
| 28. Blocks.mp3 | 2023-10-29 07:55 | 13M | |
| 29. Far.mp3 | 2023-10-29 07:57 | 7.4M | |
| 30. Intro.mp3 | 2023-10-29 08:11 | 11M | |
| Cover.jpg | 2023-10-26 12:21 | 672K | |
