![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Galvanize.mp3 | 2022-11-29 02:04 | 10M | |
| 02. Hey Boy Hey Girl.mp3 | 2022-11-29 02:04 | 11M | |
| 03. Block Rockin' Beats.mp3 | 2022-11-29 02:04 | 11M | |
| 04. Do it Again.mp3 | 2022-11-29 02:04 | 8.4M | |
| 05. Believe.mp3 | 2022-11-29 02:04 | 14M | |
| 06. Star Guitar.mp3 | 2022-11-29 02:04 | 14M | |
| 07. Let Forever Be.mp3 | 2022-11-29 02:04 | 8.5M | |
| 08. Leave Home.mp3 | 2022-11-29 02:04 | 12M | |
| 09. Keep My Composure.mp3 | 2022-11-29 02:04 | 13M | |
| 10. Saturate.mp3 | 2022-11-29 02:04 | 11M | |
| 11. Out of Control.mp3 | 2022-11-29 02:04 | 17M | |
| 12. Midnight Madness.mp3 | 2022-11-29 02:04 | 8.2M | |
| 13. The Golden Path.mp3 | 2022-11-29 02:04 | 11M | |
| 14. Setting Sun.mp3 | 2022-11-29 02:04 | 9.2M | |
| 15. Chemical Beats.mp3 | 2022-11-29 02:04 | 9.3M | |