![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Song To The Siren.mp3 | 2022-11-29 02:05 | 10M | |
| 02. Chemical Beats.mp3 | 2022-11-29 02:05 | 9.4M | |
| 03. Leave Home.mp3 | 2022-11-29 02:05 | 12M | |
| 04. Setting Sun.mp3 | 2022-11-29 02:05 | 9.3M | |
| 05. Block Rockin' Beats.mp3 | 2022-11-29 02:06 | 11M | |
| 06. The Private Psychedelic Reel.mp3 | 2022-11-29 02:05 | 21M | |
| 07. Hey Boy Hey Girl.mp3 | 2022-11-29 02:06 | 11M | |
| 08. Let Forever Be.mp3 | 2022-11-29 02:06 | 8.6M | |
| 09. Out Of Control.mp3 | 2022-11-29 02:06 | 17M | |
| 10. Star Guitar.mp3 | 2022-11-29 02:06 | 14M | |
| 11. The Test.mp3 | 2022-11-29 02:06 | 16M | |
| 12. Get Yourself High.mp3 | 2022-11-29 02:05 | 13M | |
| 13. The Golden Path.mp3 | 2022-11-29 02:05 | 11M | |
| Covers/ | 2023-10-31 07:28 | - | |