![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. ....And The Forest Began To Sing.flac | 2022-11-29 06:01 | 11M | |
| 02. Tricky Two.flac | 2022-11-29 06:01 | 45M | |
| 03. The Alcoholic.flac | 2022-11-29 06:01 | 33M | |
| 04. Senior Living.flac | 2022-11-29 06:01 | 27M | |
| 05. The Drug.flac | 2022-11-29 06:01 | 30M | |
| 06. Forsaken Cowboy.flac | 2022-11-29 06:01 | 30M | |
| 07. The Fear.flac | 2022-11-29 06:01 | 41M | |
| 08. Coming Home.flac | 2022-11-29 06:01 | 28M | |
| 09. A Long, Long Way - The Final Day.flac | 2022-11-29 06:01 | 43M | |
| Senior (Japan).cue | 2022-11-29 06:01 | 1.4K | |
| Senior (Japan).log | 2022-11-29 06:01 | 9.5K | |
| Senior (Japan).m3u | 2022-11-29 06:01 | 241 | |
| cover.jpg | 2022-11-29 06:01 | 340K | |
| covers/ | 2023-10-31 02:39 | - | |