![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Новая папка/ | 2007-10-19 21:47 | - | |
| 0103.jpg | 2007-10-16 22:25 | 122K | |
| 02 - cowgirl.sfk | 2007-10-19 22:05 | 288K | |
| 02 - cowgirl.wav | 2007-10-19 21:52 | 72M | |
| 03 - Chemical Brothers - Out of Control.mp3 | 2007-10-19 23:22 | 8.0M | |
| 03 - Chemical Brothers - Out of Control.sfk | 2007-10-19 23:15 | 71K | |
| 12.JPG | 2007-10-16 22:28 | 145K | |
| 61212.jpg | 2007-10-16 22:18 | 58K | |
| Breaks/ | 2007-11-04 09:31 | - | |
| Chemical Brothers - Out of Control.sfk | 2007-10-19 23:39 | 142K | |
| Chemical Brothers - Out of Control.wav | 2007-10-19 23:15 | 35M | |
| Drum/ | 2007-10-16 22:33 | - | |
| Earth.jpg | 2007-10-16 22:18 | 52K | |
| Trance/ | 2007-10-16 22:36 | - | |
| acid Breaks/ | 2007-12-05 01:10 | - | |
| cb.sfk | 2007-10-20 10:22 | 136K | |
| cb.wav | 2007-10-20 10:22 | 34M | |
| earth_west.jpg | 2007-10-16 22:24 | 157K | |
| skylab_nasa.jpg | 2007-10-16 22:26 | 74K | |
| split_loop_vs._stereo_mcs-connected_(split_loop_rmx).sfk | 2007-10-20 12:55 | 269K | |
| split_loop_vs._stereo_mcs-connected_(split_loop_rmx).wav | 2007-10-20 11:34 | 67M | |